C6H14Cl2O5 — CID 159024187
3-chloropropane-1,2-diol;1-chloropropane-1,2,3-triol (PubChem CID 159024187) has the molecular formula C6H14Cl2O5 and a molecular weight of 237.08 g/mol. Its IUPAC name is 3-chloropropane-1,2-diol;1-chloropropane-1,2,3-triol.
| Compound Name | 3-chloropropane-1,2-diol;1-chloropropane-1,2,3-triol |
|---|---|
| PubChem CID | 159024187 |
| Molecular Formula | C6H14Cl2O5 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 3-chloropropane-1,2-diol;1-chloropropane-1,2,3-triol |
| SMILES | OCC(O)C(O)Cl.OCC(O)CCl |
| InChI | InChI=1S/C3H7ClO3.C3H7ClO2/c4-3(7)2(6)1-5;4-1-3(6)2-5/h2-3,5-7H,1H2;3,5-6H,1-2H2 |
| InChIKey | JUBVRPFFOFYGLD-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|