C5H13ClO4 — CID 159289290
2-chloroethanol;propane-1,2,3-triol (PubChem CID 159289290) has the molecular formula C5H13ClO4 and a molecular weight of 172.61 g/mol. Its IUPAC name is 2-chloroethanol;propane-1,2,3-triol.
| Compound Name | 2-chloroethanol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 159289290 |
| Molecular Formula | C5H13ClO4 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2-chloroethanol;propane-1,2,3-triol |
| SMILES | OCC(O)CO.OCCCl |
| InChI | InChI=1S/C3H8O3.C2H5ClO/c4-1-3(6)2-5;3-1-2-4/h3-6H,1-2H2;4H,1-2H2 |
| InChIKey | KZXFVCPEOQCEAF-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|