C12H18ClNO4 — CID 168637818
1-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]propane-1,2,3-triol (PubChem CID 168637818) has the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. Its IUPAC name is 1-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]propane-1,2,3-triol.
| Compound Name | 1-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 168637818 |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc(NCC(O)CCl)cc1 |
| InChI | InChI=1S/C12H18ClNO4/c13-5-10(16)6-14-9-3-1-8(2-4-9)12(18)11(17)7-15/h1-4,10-12,14-18H,5-7H2 |
| InChIKey | MPIJLWJRLDOFBQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|