C10H13NO4 — CID 168654124
N-[4-(1,2,3-trihydroxypropyl)phenyl]formamide (PubChem CID 168654124) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-[4-(1,2,3-trihydroxypropyl)phenyl]formamide.
| Compound Name | N-[4-(1,2,3-trihydroxypropyl)phenyl]formamide |
|---|---|
| PubChem CID | 168654124 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-[4-(1,2,3-trihydroxypropyl)phenyl]formamide |
| SMILES | O=CNc1ccc(C(O)C(O)CO)cc1 |
| InChI | InChI=1S/C10H13NO4/c12-5-9(14)10(15)7-1-3-8(4-2-7)11-6-13/h1-4,6,9-10,12,14-15H,5H2,(H,11,13) |
| InChIKey | ASBQSBYSOLMNLH-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|