C10H11ClO4 — CID 170817757
2-chloro-5-(1,2,3-trihydroxypropyl)benzaldehyde (PubChem CID 170817757) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-chloro-5-(1,2,3-trihydroxypropyl)benzaldehyde.
| Compound Name | 2-chloro-5-(1,2,3-trihydroxypropyl)benzaldehyde |
|---|---|
| PubChem CID | 170817757 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-chloro-5-(1,2,3-trihydroxypropyl)benzaldehyde |
| SMILES | O=Cc1cc(C(O)C(O)CO)ccc1Cl |
| InChI | InChI=1S/C10H11ClO4/c11-8-2-1-6(3-7(8)4-12)10(15)9(14)5-13/h1-4,9-10,13-15H,5H2 |
| InChIKey | KTJPHTSFTLAMDY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|