About 2-chloro-5-propan-2-ylbenzaldehyde;methanamine
2-chloro-5-propan-2-ylbenzaldehyde;methanamine (PubChem CID 168894459) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-chloro-5-propan-2-ylbenzaldehyde;methanamine.
Molecular Properties
| Compound Name | 2-chloro-5-propan-2-ylbenzaldehyde;methanamine |
| PubChem CID | 168894459 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-chloro-5-propan-2-ylbenzaldehyde;methanamine |
| SMILES | CC(C)c1ccc(Cl)c(C=O)c1.CN |
| InChI | InChI=1S/C10H11ClO.CH5N/c1-7(2)8-3-4-10(11)9(5-8)6-12;1-2/h3-7H,1-2H3;2H2,1H3 |
| InChIKey | KFZCZKCMMWHIDM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-propan-2-ylbenzaldehyde;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-propan-2-ylbenzaldehyde;methanamine?
The IUPAC name of 2-chloro-5-propan-2-ylbenzaldehyde;methanamine (CID 168894459) is 2-chloro-5-propan-2-ylbenzaldehyde;methanamine.
What is the SMILES notation for 2-chloro-5-propan-2-ylbenzaldehyde;methanamine?
The canonical SMILES for 2-chloro-5-propan-2-ylbenzaldehyde;methanamine is CC(C)c1ccc(Cl)c(C=O)c1.CN.
What is the InChIKey of 2-chloro-5-propan-2-ylbenzaldehyde;methanamine?
The InChIKey is KFZCZKCMMWHIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO.CH5N/c1-7(2)8-3-4-10(11)9(5-8)6-12;1-2/h3-7H,1-2H3;2H2,1H3.
What are the key properties of 2-chloro-5-propan-2-ylbenzaldehyde;methanamine?
2-chloro-5-propan-2-ylbenzaldehyde;methanamine has a molecular weight of 213.71 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-propan-2-ylbenzaldehyde;methanamine is sourced from PubChem (CID 168894459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).