C10H10ClNO5 — CID 171862741
5-(3-chloro-1,2-dihydroxypropyl)-2-nitrobenzaldehyde (PubChem CID 171862741) has the molecular formula C10H10ClNO5 and a molecular weight of 259.64 g/mol. Its IUPAC name is 5-(3-chloro-1,2-dihydroxypropyl)-2-nitrobenzaldehyde.
| Compound Name | 5-(3-chloro-1,2-dihydroxypropyl)-2-nitrobenzaldehyde |
|---|---|
| PubChem CID | 171862741 |
| Molecular Formula | C10H10ClNO5 |
| Molecular Weight | 259.64 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-(3-chloro-1,2-dihydroxypropyl)-2-nitrobenzaldehyde |
| SMILES | O=Cc1cc(C(O)C(O)CCl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10ClNO5/c11-4-9(14)10(15)6-1-2-8(12(16)17)7(3-6)5-13/h1-3,5,9-10,14-15H,4H2 |
| InChIKey | LABCQPZXFXPBHM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|