C11H10N2O6 — CID 171901883
4-(3-formyl-4-hydroxy-5-nitrophenyl)-3,4-dihydroxybutanenitrile (PubChem CID 171901883) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is 4-(3-formyl-4-hydroxy-5-nitrophenyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(3-formyl-4-hydroxy-5-nitrophenyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901883 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 4-(3-formyl-4-hydroxy-5-nitrophenyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cc(C=O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10N2O6/c12-2-1-9(15)11(17)6-3-7(5-14)10(16)8(4-6)13(18)19/h3-5,9,11,15-17H,1H2 |
| InChIKey | OLEFPNGFUXKMGJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|