C11H11NO7 — CID 171878383
4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878383) has the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. Its IUPAC name is 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878383 |
| Molecular Formula | C11H11NO7 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=Cc1cc(C(O)C(O)CC(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO7/c13-5-7-3-6(1-2-8(7)12(18)19)11(17)9(14)4-10(15)16/h1-3,5,9,11,14,17H,4H2,(H,15,16) |
| InChIKey | FEIHEWWWKHCNBA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|