4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid

C11H11NO7 — CID 171878383

IUPAC4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid
SMILESO=Cc1cc(C(O)C(O)CC(=O)O)ccc1[N+](=O)[O-]
InChIInChI=1S/C11H11NO7/c13-5-7-3-6(1-2-8(7)12(18)19)11(17)9(14)4-10(15)16/h1-3,5,9,11,14,17H,4H2,(H,15,16)
InChIKeyFEIHEWWWKHCNBA-UHFFFAOYSA-N
MW269.21 g/mol
LogP0.28
Rot. Bonds6

About 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid

4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878383) has the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. Its IUPAC name is 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid.

Molecular Properties

Compound Name4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid
PubChem CID171878383
Molecular FormulaC11H11NO7
Molecular Weight269.21 g/mol
Exact Mass269.05
IUPAC Name4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid
SMILESO=Cc1cc(C(O)C(O)CC(=O)O)ccc1[N+](=O)[O-]
InChIInChI=1S/C11H11NO7/c13-5-7-3-6(1-2-8(7)12(18)19)11(17)9(14)4-10(15)16/h1-3,5,9,11,14,17H,4H2,(H,15,16)
InChIKeyFEIHEWWWKHCNBA-UHFFFAOYSA-N
XLogP0.28
TPSA137.97 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.21
LogP ≤ 50.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid?
The IUPAC name of 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid (CID 171878383) is 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid.
What is the SMILES notation for 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid?
The canonical SMILES for 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid is O=Cc1cc(C(O)C(O)CC(=O)O)ccc1[N+](=O)[O-].
What is the InChIKey of 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid?
The InChIKey is FEIHEWWWKHCNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO7/c13-5-7-3-6(1-2-8(7)12(18)19)11(17)9(14)4-10(15)16/h1-3,5,9,11,14,17H,4H2,(H,15,16).
What are the key properties of 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid?
4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid has a molecular weight of 269.21 g/mol, XLogP of 0.28, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-formyl-4-nitrophenyl)-3,4-dihydroxybutanoic acid is sourced from PubChem (CID 171878383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).