C11H13NO7 — CID 171873213
2-nitro-5-(1,2,4-trihydroxybutyl)benzoic acid (PubChem CID 171873213) has the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. Its IUPAC name is 2-nitro-5-(1,2,4-trihydroxybutyl)benzoic acid.
| Compound Name | 2-nitro-5-(1,2,4-trihydroxybutyl)benzoic acid |
|---|---|
| PubChem CID | 171873213 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-nitro-5-(1,2,4-trihydroxybutyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(O)C(O)CCO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO7/c13-4-3-9(14)10(15)6-1-2-8(12(18)19)7(5-6)11(16)17/h1-2,5,9-10,13-15H,3-4H2,(H,16,17) |
| InChIKey | IWITUKNMSLAJHL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|