C13H15NO8 — CID 171898295
5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-nitrobenzoic acid (PubChem CID 171898295) has the molecular formula C13H15NO8 and a molecular weight of 313.26 g/mol. Its IUPAC name is 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-nitrobenzoic acid.
| Compound Name | 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 171898295 |
| Molecular Formula | C13H15NO8 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-nitrobenzoic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C13H15NO8/c1-2-22-11(16)6-10(15)12(17)7-3-4-9(14(20)21)8(5-7)13(18)19/h3-5,10,12,15,17H,2,6H2,1H3,(H,18,19) |
| InChIKey | INPOKXZUDBZYGA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|