C12H15NO7 — CID 171897881
ethyl 3,4-dihydroxy-4-(3-hydroxy-4-nitrophenyl)butanoate (PubChem CID 171897881) has the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(3-hydroxy-4-nitrophenyl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(3-hydroxy-4-nitrophenyl)butanoate |
|---|---|
| PubChem CID | 171897881 |
| Molecular Formula | C12H15NO7 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(3-hydroxy-4-nitrophenyl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C12H15NO7/c1-2-20-11(16)6-10(15)12(17)7-3-4-8(13(18)19)9(14)5-7/h3-5,10,12,14-15,17H,2,6H2,1H3 |
| InChIKey | GGRAMRROLQVPKW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|