C16H24O5 — CID 171897974
ethyl 4-(3-tert-butyl-4-hydroxyphenyl)-3,4-dihydroxybutanoate (PubChem CID 171897974) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is ethyl 4-(3-tert-butyl-4-hydroxyphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(3-tert-butyl-4-hydroxyphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897974 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethyl 4-(3-tert-butyl-4-hydroxyphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24O5/c1-5-21-14(19)9-13(18)15(20)10-6-7-12(17)11(8-10)16(2,3)4/h6-8,13,15,17-18,20H,5,9H2,1-4H3 |
| InChIKey | XEFCDIXDAUQNKB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |