C14H14O7 — CID 171898129
ethyl 4-(1,3-dioxo-2-benzofuran-5-yl)-3,4-dihydroxybutanoate (PubChem CID 171898129) has the molecular formula C14H14O7 and a molecular weight of 294.26 g/mol. Its IUPAC name is ethyl 4-(1,3-dioxo-2-benzofuran-5-yl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(1,3-dioxo-2-benzofuran-5-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898129 |
| Molecular Formula | C14H14O7 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | ethyl 4-(1,3-dioxo-2-benzofuran-5-yl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C14H14O7/c1-2-20-11(16)6-10(15)12(17)7-3-4-8-9(5-7)14(19)21-13(8)18/h3-5,10,12,15,17H,2,6H2,1H3 |
| InChIKey | KTIFLXGIKVUQHC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|