C13H18N2O5 — CID 171897778
ethyl 4-[3-(hydrazinecarbonyl)phenyl]-3,4-dihydroxybutanoate (PubChem CID 171897778) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is ethyl 4-[3-(hydrazinecarbonyl)phenyl]-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-[3-(hydrazinecarbonyl)phenyl]-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897778 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethyl 4-[3-(hydrazinecarbonyl)phenyl]-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C13H18N2O5/c1-2-20-11(17)7-10(16)12(18)8-4-3-5-9(6-8)13(19)15-14/h3-6,10,12,16,18H,2,7,14H2,1H3,(H,15,19) |
| InChIKey | FXAPLHFQPYZTJJ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|