C12H16N2O4 — CID 171895560
methyl 4-(3-carbamimidoylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171895560) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 4-(3-carbamimidoylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(3-carbamimidoylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895560 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methyl 4-(3-carbamimidoylphenyl)-3,4-dihydroxybutanoate |
| SMILES | [H]/N=C(\N)c1cccc(C(O)C(O)CC(=O)OC)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-18-10(16)6-9(15)11(17)7-3-2-4-8(5-7)12(13)14/h2-5,9,11,15,17H,6H2,1H3,(H3,13,14) |
| InChIKey | KGDZPWLAPFIONP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|