C12H13NO5 — CID 171895715
methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate (PubChem CID 171895715) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate |
|---|---|
| PubChem CID | 171895715 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1cccc(N=C=O)c1 |
| InChI | InChI=1S/C12H13NO5/c1-18-11(16)6-10(15)12(17)8-3-2-4-9(5-8)13-7-14/h2-5,10,12,15,17H,6H2,1H3 |
| InChIKey | LHNQXLSUWQHNFK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|