methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate

C12H13NO5 — CID 171895715

IUPACmethyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate
SMILESCOC(=O)CC(O)C(O)c1cccc(N=C=O)c1
InChIInChI=1S/C12H13NO5/c1-18-11(16)6-10(15)12(17)8-3-2-4-9(5-8)13-7-14/h2-5,10,12,15,17H,6H2,1H3
InChIKeyLHNQXLSUWQHNFK-UHFFFAOYSA-N
MW251.24 g/mol
LogP0.61
Rot. Bonds5

About methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate

methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate (PubChem CID 171895715) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate.

Molecular Properties

Compound Namemethyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate
PubChem CID171895715
Molecular FormulaC12H13NO5
Molecular Weight251.24 g/mol
Exact Mass251.08
IUPAC Namemethyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate
SMILESCOC(=O)CC(O)C(O)c1cccc(N=C=O)c1
InChIInChI=1S/C12H13NO5/c1-18-11(16)6-10(15)12(17)8-3-2-4-9(5-8)13-7-14/h2-5,10,12,15,17H,6H2,1H3
InChIKeyLHNQXLSUWQHNFK-UHFFFAOYSA-N
XLogP0.61
TPSA96.19 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.24
LogP ≤ 50.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}

Analyze methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate?
The IUPAC name of methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate (CID 171895715) is methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate.
What is the SMILES notation for methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate?
The canonical SMILES for methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate is COC(=O)CC(O)C(O)c1cccc(N=C=O)c1.
What is the InChIKey of methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate?
The InChIKey is LHNQXLSUWQHNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO5/c1-18-11(16)6-10(15)12(17)8-3-2-4-9(5-8)13-7-14/h2-5,10,12,15,17H,6H2,1H3.
What are the key properties of methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate?
methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate has a molecular weight of 251.24 g/mol, XLogP of 0.61, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4-dihydroxy-4-(3-isocyanatophenyl)butanoate is sourced from PubChem (CID 171895715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).