C10H12N2O3 — CID 170828162
3-amino-1-(3-isocyanatophenyl)propane-1,2-diol (PubChem CID 170828162) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-amino-1-(3-isocyanatophenyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(3-isocyanatophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170828162 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-amino-1-(3-isocyanatophenyl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cccc(N=C=O)c1 |
| InChI | InChI=1S/C10H12N2O3/c11-5-9(14)10(15)7-2-1-3-8(4-7)12-6-13/h1-4,9-10,14-15H,5,11H2 |
| InChIKey | BMYAGGDMTCLRMJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|