C30H28N8O8 — CID 160975512
1,3-diisocyanatobenzene;1,4-diisocyanatobenzene;1,4-diisocyanatobutane;1,6-diisocyanatohexane (PubChem CID 160975512) has the molecular formula C30H28N8O8 and a molecular weight of 628.60 g/mol. Its IUPAC name is 1,3-diisocyanatobenzene;1,4-diisocyanatobenzene;1,4-diisocyanatobutane;1,6-diisocyanatohexane.
| Compound Name | 1,3-diisocyanatobenzene;1,4-diisocyanatobenzene;1,4-diisocyanatobutane;1,6-diisocyanatohexane |
|---|---|
| PubChem CID | 160975512 |
| Molecular Formula | C30H28N8O8 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | 1,3-diisocyanatobenzene;1,4-diisocyanatobenzene;1,4-diisocyanatobutane;1,6-diisocyanatohexane |
| SMILES | O=C=NCCCCCCN=C=O.O=C=NCCCCN=C=O.O=C=Nc1ccc(N=C=O)cc1.O=C=Nc1cccc(N=C=O)c1 |
| InChI | InChI=1S/2C8H4N2O2.C8H12N2O2.C6H8N2O2/c11-5-9-7-1-2-8(4-3-7)10-6-12;11-5-9-7-2-1-3-8(4-7)10-6-12;11-7-9-5-3-1-2-4-6-10-8-12;9-5-7-3-1-2-4-8-6-10/h2*1-4H;1-6H2;1-4H2 |
| InChIKey | SYUSWCAFPCEEGZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 235.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|