About aniline;chloroform;isocyanatobenzene
aniline;chloroform;isocyanatobenzene (PubChem CID 163853457) has the molecular formula C14H13Cl3N2O
and a molecular weight of 331.63 g/mol. Its IUPAC name is aniline;chloroform;isocyanatobenzene.
Molecular Properties
| Compound Name | aniline;chloroform;isocyanatobenzene |
| PubChem CID | 163853457 |
| Molecular Formula | C14H13Cl3N2O |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | aniline;chloroform;isocyanatobenzene |
| SMILES | ClC(Cl)Cl.Nc1ccccc1.O=C=Nc1ccccc1 |
| InChI | InChI=1S/C7H5NO.C6H7N.CHCl3/c9-6-8-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6;2-1(3)4/h1-5H;1-5H,7H2;1H |
| InChIKey | OWIALNLCVNFHFW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze aniline;chloroform;isocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;chloroform;isocyanatobenzene?
The IUPAC name of aniline;chloroform;isocyanatobenzene (CID 163853457) is aniline;chloroform;isocyanatobenzene.
What is the SMILES notation for aniline;chloroform;isocyanatobenzene?
The canonical SMILES for aniline;chloroform;isocyanatobenzene is ClC(Cl)Cl.Nc1ccccc1.O=C=Nc1ccccc1.
What is the InChIKey of aniline;chloroform;isocyanatobenzene?
The InChIKey is OWIALNLCVNFHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C6H7N.CHCl3/c9-6-8-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6;2-1(3)4/h1-5H;1-5H,7H2;1H.
What are the key properties of aniline;chloroform;isocyanatobenzene?
aniline;chloroform;isocyanatobenzene has a molecular weight of 331.63 g/mol, XLogP of 4.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;chloroform;isocyanatobenzene is sourced from PubChem (CID 163853457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).