About isocyanatobenzene;1-isocyanato-4-methylbenzene
isocyanatobenzene;1-isocyanato-4-methylbenzene (PubChem CID 20510749) has the molecular formula C15H12N2O2
and a molecular weight of 252.27 g/mol. Its IUPAC name is isocyanatobenzene;1-isocyanato-4-methylbenzene.
Molecular Properties
| Compound Name | isocyanatobenzene;1-isocyanato-4-methylbenzene |
| PubChem CID | 20510749 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | isocyanatobenzene;1-isocyanato-4-methylbenzene |
| SMILES | Cc1ccc(N=C=O)cc1.O=C=Nc1ccccc1 |
| InChI | InChI=1S/C8H7NO.C7H5NO/c1-7-2-4-8(5-3-7)9-6-10;9-6-8-7-4-2-1-3-5-7/h2-5H,1H3;1-5H |
| InChIKey | DNPUDOJDPGRKTC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanatobenzene;1-isocyanato-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanatobenzene;1-isocyanato-4-methylbenzene?
The IUPAC name of isocyanatobenzene;1-isocyanato-4-methylbenzene (CID 20510749) is isocyanatobenzene;1-isocyanato-4-methylbenzene.
What is the SMILES notation for isocyanatobenzene;1-isocyanato-4-methylbenzene?
The canonical SMILES for isocyanatobenzene;1-isocyanato-4-methylbenzene is Cc1ccc(N=C=O)cc1.O=C=Nc1ccccc1.
What is the InChIKey of isocyanatobenzene;1-isocyanato-4-methylbenzene?
The InChIKey is DNPUDOJDPGRKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.C7H5NO/c1-7-2-4-8(5-3-7)9-6-10;9-6-8-7-4-2-1-3-5-7/h2-5H,1H3;1-5H.
What are the key properties of isocyanatobenzene;1-isocyanato-4-methylbenzene?
isocyanatobenzene;1-isocyanato-4-methylbenzene has a molecular weight of 252.27 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanatobenzene;1-isocyanato-4-methylbenzene is sourced from PubChem (CID 20510749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).