C16H8N4O4 — CID 160659088
1,2-diisocyanatobenzene;1,4-diisocyanatobenzene (PubChem CID 160659088) has the molecular formula C16H8N4O4 and a molecular weight of 320.26 g/mol. Its IUPAC name is 1,2-diisocyanatobenzene;1,4-diisocyanatobenzene.
| Compound Name | 1,2-diisocyanatobenzene;1,4-diisocyanatobenzene |
|---|---|
| PubChem CID | 160659088 |
| Molecular Formula | C16H8N4O4 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1,2-diisocyanatobenzene;1,4-diisocyanatobenzene |
| SMILES | O=C=Nc1ccc(N=C=O)cc1.O=C=Nc1ccccc1N=C=O |
| InChI | InChI=1S/2C8H4N2O2/c11-5-9-7-1-2-8(4-3-7)10-6-12;11-5-9-7-3-1-2-4-8(7)10-6-12/h2*1-4H |
| InChIKey | RLKXLRSBHQAEDK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|