About 1,2-diisocyanatobenzene;ethene
1,2-diisocyanatobenzene;ethene (PubChem CID 159765986) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 1,2-diisocyanatobenzene;ethene.
Molecular Properties
| Compound Name | 1,2-diisocyanatobenzene;ethene |
| PubChem CID | 159765986 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1,2-diisocyanatobenzene;ethene |
| SMILES | C=C.O=C=Nc1ccccc1N=C=O |
| InChI | InChI=1S/C8H4N2O2.C2H4/c11-5-9-7-3-1-2-4-8(7)10-6-12;1-2/h1-4H;1-2H2 |
| InChIKey | NFMUODNBRAVFPP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diisocyanatobenzene;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diisocyanatobenzene;ethene?
The IUPAC name of 1,2-diisocyanatobenzene;ethene (CID 159765986) is 1,2-diisocyanatobenzene;ethene.
What is the SMILES notation for 1,2-diisocyanatobenzene;ethene?
The canonical SMILES for 1,2-diisocyanatobenzene;ethene is C=C.O=C=Nc1ccccc1N=C=O.
What is the InChIKey of 1,2-diisocyanatobenzene;ethene?
The InChIKey is NFMUODNBRAVFPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2.C2H4/c11-5-9-7-3-1-2-4-8(7)10-6-12;1-2/h1-4H;1-2H2.
What are the key properties of 1,2-diisocyanatobenzene;ethene?
1,2-diisocyanatobenzene;ethene has a molecular weight of 188.19 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diisocyanatobenzene;ethene is sourced from PubChem (CID 159765986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).