About 2-bromo-1,3-diisocyanatobenzene;ethane
2-bromo-1,3-diisocyanatobenzene;ethane (PubChem CID 159499230) has the molecular formula C10H9BrN2O2
and a molecular weight of 269.10 g/mol. Its IUPAC name is 2-bromo-1,3-diisocyanatobenzene;ethane.
Molecular Properties
| Compound Name | 2-bromo-1,3-diisocyanatobenzene;ethane |
| PubChem CID | 159499230 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 2-bromo-1,3-diisocyanatobenzene;ethane |
| SMILES | CC.O=C=Nc1cccc(N=C=O)c1Br |
| InChI | InChI=1S/C8H3BrN2O2.C2H6/c9-8-6(10-4-12)2-1-3-7(8)11-5-13;1-2/h1-3H;1-2H3 |
| InChIKey | LZECWTGVXMZVLP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,3-diisocyanatobenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-diisocyanatobenzene;ethane?
The IUPAC name of 2-bromo-1,3-diisocyanatobenzene;ethane (CID 159499230) is 2-bromo-1,3-diisocyanatobenzene;ethane.
What is the SMILES notation for 2-bromo-1,3-diisocyanatobenzene;ethane?
The canonical SMILES for 2-bromo-1,3-diisocyanatobenzene;ethane is CC.O=C=Nc1cccc(N=C=O)c1Br.
What is the InChIKey of 2-bromo-1,3-diisocyanatobenzene;ethane?
The InChIKey is LZECWTGVXMZVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrN2O2.C2H6/c9-8-6(10-4-12)2-1-3-7(8)11-5-13;1-2/h1-3H;1-2H3.
What are the key properties of 2-bromo-1,3-diisocyanatobenzene;ethane?
2-bromo-1,3-diisocyanatobenzene;ethane has a molecular weight of 269.10 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-diisocyanatobenzene;ethane is sourced from PubChem (CID 159499230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).