C12H12N2O2 — CID 87259034
2-butyl-1,3-diisocyanatobenzene (PubChem CID 87259034) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-butyl-1,3-diisocyanatobenzene.
| Compound Name | 2-butyl-1,3-diisocyanatobenzene |
|---|---|
| PubChem CID | 87259034 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-butyl-1,3-diisocyanatobenzene |
| SMILES | CCCCc1c(N=C=O)cccc1N=C=O |
| InChI | InChI=1S/C12H12N2O2/c1-2-3-5-10-11(13-8-15)6-4-7-12(10)14-9-16/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | HXLLOPQSUJZUKH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|