C9H10N2O — CID 169353339
2-isocyanato-N,6-dimethylaniline (PubChem CID 169353339) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-isocyanato-N,6-dimethylaniline.
| Compound Name | 2-isocyanato-N,6-dimethylaniline |
|---|---|
| PubChem CID | 169353339 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-isocyanato-N,6-dimethylaniline |
| SMILES | CNc1c(C)cccc1N=C=O |
| InChI | InChI=1S/C9H10N2O/c1-7-4-3-5-8(11-6-12)9(7)10-2/h3-5,10H,1-2H3 |
| InChIKey | NBDIIQVBILTTGG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|