C25H16N4O4 — CID 87528112
1-[bis(2-isocyanato-3-methylphenyl)methyl]-2,3-diisocyanatobenzene (PubChem CID 87528112) has the molecular formula C25H16N4O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is 1-[bis(2-isocyanato-3-methylphenyl)methyl]-2,3-diisocyanatobenzene.
| Compound Name | 1-[bis(2-isocyanato-3-methylphenyl)methyl]-2,3-diisocyanatobenzene |
|---|---|
| PubChem CID | 87528112 |
| Molecular Formula | C25H16N4O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 1-[bis(2-isocyanato-3-methylphenyl)methyl]-2,3-diisocyanatobenzene |
| SMILES | Cc1cccc(C(c2cccc(C)c2N=C=O)c2cccc(N=C=O)c2N=C=O)c1N=C=O |
| InChI | InChI=1S/C25H16N4O4/c1-16-6-3-8-18(23(16)27-13-31)22(19-9-4-7-17(2)24(19)28-14-32)20-10-5-11-21(26-12-30)25(20)29-15-33/h3-11,22H,1-2H3 |
| InChIKey | MFGDFPVXVSJBQV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|