C23H30N2 — CID 20719131
N'-[2,6-di(propan-2-yl)phenyl]-N-(2-methyl-6-propan-2-ylphenyl)methanediimine (PubChem CID 20719131) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is N'-[2,6-di(propan-2-yl)phenyl]-N-(2-methyl-6-propan-2-ylphenyl)methanediimine.
| Compound Name | N'-[2,6-di(propan-2-yl)phenyl]-N-(2-methyl-6-propan-2-ylphenyl)methanediimine |
|---|---|
| PubChem CID | 20719131 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N'-[2,6-di(propan-2-yl)phenyl]-N-(2-methyl-6-propan-2-ylphenyl)methanediimine |
| SMILES | Cc1cccc(C(C)C)c1N=C=Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C23H30N2/c1-15(2)19-11-8-10-18(7)22(19)24-14-25-23-20(16(3)4)12-9-13-21(23)17(5)6/h8-13,15-17H,1-7H3 |
| InChIKey | NNUPGMXVMCSRNJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|