C21H28N2 — CID 20660934
N,N'-bis(2-methyl-6-propan-2-ylphenyl)methanimidamide (PubChem CID 20660934) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N,N'-bis(2-methyl-6-propan-2-ylphenyl)methanimidamide.
| Compound Name | N,N'-bis(2-methyl-6-propan-2-ylphenyl)methanimidamide |
|---|---|
| PubChem CID | 20660934 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N,N'-bis(2-methyl-6-propan-2-ylphenyl)methanimidamide |
| SMILES | Cc1cccc(C(C)C)c1/N=C/Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C21H28N2/c1-14(2)18-11-7-9-16(5)20(18)22-13-23-21-17(6)10-8-12-19(21)15(3)4/h7-15H,1-6H3,(H,22,23) |
| InChIKey | WGEOYFDXVRYAEC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|