C25H34N2 — CID 101126797
2-methyl-N-[(Z)-4-(2-methyl-6-propan-2-ylphenyl)iminopent-2-en-2-yl]-6-propan-2-ylaniline (PubChem CID 101126797) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 2-methyl-N-[(Z)-4-(2-methyl-6-propan-2-ylphenyl)iminopent-2-en-2-yl]-6-propan-2-ylaniline.
| Compound Name | 2-methyl-N-[(Z)-4-(2-methyl-6-propan-2-ylphenyl)iminopent-2-en-2-yl]-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 101126797 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 2-methyl-N-[(Z)-4-(2-methyl-6-propan-2-ylphenyl)iminopent-2-en-2-yl]-6-propan-2-ylaniline |
| SMILES | C/C(=C/C(C)=N/c1c(C)cccc1C(C)C)Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C25H34N2/c1-16(2)22-13-9-11-18(5)24(22)26-20(7)15-21(8)27-25-19(6)12-10-14-23(25)17(3)4/h9-17,26H,1-8H3/b20-15-,27-21+ |
| InChIKey | YCFSDJROEVNNOQ-LZYXZRDISA-N |
| XLogP | 7.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|