C30H39N3 — CID 20660748
2-[(dimethylamino)methyl]-N,N'-bis(2-methyl-6-propan-2-ylphenyl)benzenecarboximidamide (PubChem CID 20660748) has the molecular formula C30H39N3 and a molecular weight of 441.66 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-N,N'-bis(2-methyl-6-propan-2-ylphenyl)benzenecarboximidamide.
| Compound Name | 2-[(dimethylamino)methyl]-N,N'-bis(2-methyl-6-propan-2-ylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 20660748 |
| Molecular Formula | C30H39N3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 2-[(dimethylamino)methyl]-N,N'-bis(2-methyl-6-propan-2-ylphenyl)benzenecarboximidamide |
| SMILES | Cc1cccc(C(C)C)c1/N=C(/Nc1c(C)cccc1C(C)C)c1ccccc1CN(C)C |
| InChI | InChI=1S/C30H39N3/c1-20(2)25-17-11-13-22(5)28(25)31-30(27-16-10-9-15-24(27)19-33(7)8)32-29-23(6)14-12-18-26(29)21(3)4/h9-18,20-21H,19H2,1-8H3,(H,31,32) |
| InChIKey | KZVZPLKDPLDCQR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|