C29H36N2 — CID 101440233
N-[2-[2,6-di(propan-2-yl)phenyl]imino-3-phenylpropyl]-2,6-dimethylaniline (PubChem CID 101440233) has the molecular formula C29H36N2 and a molecular weight of 412.62 g/mol. Its IUPAC name is N-[2-[2,6-di(propan-2-yl)phenyl]imino-3-phenylpropyl]-2,6-dimethylaniline.
| Compound Name | N-[2-[2,6-di(propan-2-yl)phenyl]imino-3-phenylpropyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 101440233 |
| Molecular Formula | C29H36N2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | N-[2-[2,6-di(propan-2-yl)phenyl]imino-3-phenylpropyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NC/C(Cc1ccccc1)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H36N2/c1-20(2)26-16-11-17-27(21(3)4)29(26)31-25(18-24-14-8-7-9-15-24)19-30-28-22(5)12-10-13-23(28)6/h7-17,20-21,30H,18-19H2,1-6H3/b31-25+ |
| InChIKey | ZELZARWFLLLSPB-QCKNELIISA-N |
| XLogP | 7.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|