C24H28N2 — CID 136753166
N-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1-(1H-pyrrol-2-yl)ethanimine (PubChem CID 136753166) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1-(1H-pyrrol-2-yl)ethanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1-(1H-pyrrol-2-yl)ethanimine |
|---|---|
| PubChem CID | 136753166 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1-(1H-pyrrol-2-yl)ethanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\Cc1ccccc1)c1ccc[nH]1 |
| InChI | InChI=1S/C24H28N2/c1-17(2)20-12-8-13-21(18(3)4)24(20)26-23(22-14-9-15-25-22)16-19-10-6-5-7-11-19/h5-15,17-18,25H,16H2,1-4H3/b26-23+ |
| InChIKey | KWWIDVQAGPPNFZ-WNAAXNPUSA-N |
| XLogP | 6.62 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|