C25H28N2 — CID 102278208
N-[2-(2,6-dimethylphenyl)imino-3-phenylpropyl]-2,6-dimethylaniline (PubChem CID 102278208) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenyl)imino-3-phenylpropyl]-2,6-dimethylaniline.
| Compound Name | N-[2-(2,6-dimethylphenyl)imino-3-phenylpropyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 102278208 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[2-(2,6-dimethylphenyl)imino-3-phenylpropyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1/N=C(/CNc1c(C)cccc1C)Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2/c1-18-10-8-11-19(2)24(18)26-17-23(16-22-14-6-5-7-15-22)27-25-20(3)12-9-13-21(25)4/h5-15,26H,16-17H2,1-4H3/b27-23+ |
| InChIKey | AJTFSSFRIYAFTI-SLEBQGDGSA-N |
| XLogP | 6.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|