C15H17NO — CID 4863460
2-[(2,6-dimethylanilino)methyl]phenol (PubChem CID 4863460) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[(2,6-dimethylanilino)methyl]phenol.
| Compound Name | 2-[(2,6-dimethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 4863460 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[(2,6-dimethylanilino)methyl]phenol |
| SMILES | Cc1cccc(C)c1NCc1ccccc1O |
| InChI | InChI=1S/C15H17NO/c1-11-6-5-7-12(2)15(11)16-10-13-8-3-4-9-14(13)17/h3-9,16-17H,10H2,1-2H3 |
| InChIKey | YUAJPCNFGBVHCB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|