C15H16BrN — CID 55024912
N-[(2-bromophenyl)methyl]-2,6-dimethylaniline (PubChem CID 55024912) has the molecular formula C15H16BrN and a molecular weight of 290.20 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2,6-dimethylaniline.
| Compound Name | N-[(2-bromophenyl)methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 55024912 |
| Molecular Formula | C15H16BrN |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NCc1ccccc1Br |
| InChI | InChI=1S/C15H16BrN/c1-11-6-5-7-12(2)15(11)17-10-13-8-3-4-9-14(13)16/h3-9,17H,10H2,1-2H3 |
| InChIKey | QHOYPOXIBLLQGJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |