C13H10BrF2N — CID 28879071
N-[(2-bromophenyl)methyl]-2,6-difluoroaniline (PubChem CID 28879071) has the molecular formula C13H10BrF2N and a molecular weight of 298.13 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2,6-difluoroaniline.
| Compound Name | N-[(2-bromophenyl)methyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 28879071 |
| Molecular Formula | C13H10BrF2N |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2,6-difluoroaniline |
| SMILES | Fc1cccc(F)c1NCc1ccccc1Br |
| InChI | InChI=1S/C13H10BrF2N/c14-10-5-2-1-4-9(10)8-17-13-11(15)6-3-7-12(13)16/h1-7,17H,8H2 |
| InChIKey | GKDUTNNZFUOMBV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |