C13H9BrF3N — CID 107598130
2-bromo-N-[(2,3-difluorophenyl)methyl]-6-fluoroaniline (PubChem CID 107598130) has the molecular formula C13H9BrF3N and a molecular weight of 316.12 g/mol. Its IUPAC name is 2-bromo-N-[(2,3-difluorophenyl)methyl]-6-fluoroaniline.
| Compound Name | 2-bromo-N-[(2,3-difluorophenyl)methyl]-6-fluoroaniline |
|---|---|
| PubChem CID | 107598130 |
| Molecular Formula | C13H9BrF3N |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-bromo-N-[(2,3-difluorophenyl)methyl]-6-fluoroaniline |
| SMILES | Fc1cccc(CNc2c(F)cccc2Br)c1F |
| InChI | InChI=1S/C13H9BrF3N/c14-9-4-2-6-11(16)13(9)18-7-8-3-1-5-10(15)12(8)17/h1-6,18H,7H2 |
| InChIKey | KHLRUUSCBGWVFD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |