C14H15NO2 — CID 61320102
3-[(2-methylanilino)methyl]benzene-1,2-diol (PubChem CID 61320102) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-[(2-methylanilino)methyl]benzene-1,2-diol.
| Compound Name | 3-[(2-methylanilino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 61320102 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-[(2-methylanilino)methyl]benzene-1,2-diol |
| SMILES | Cc1ccccc1NCc1cccc(O)c1O |
| InChI | InChI=1S/C14H15NO2/c1-10-5-2-3-7-12(10)15-9-11-6-4-8-13(16)14(11)17/h2-8,15-17H,9H2,1H3 |
| InChIKey | BABYUSSREMVVAC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|