C14H12N2O2 — CID 61317436
2-[(2,3-dihydroxyphenyl)methylamino]benzonitrile (PubChem CID 61317436) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[(2,3-dihydroxyphenyl)methylamino]benzonitrile.
| Compound Name | 2-[(2,3-dihydroxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 61317436 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-[(2,3-dihydroxyphenyl)methylamino]benzonitrile |
| SMILES | N#Cc1ccccc1NCc1cccc(O)c1O |
| InChI | InChI=1S/C14H12N2O2/c15-8-10-4-1-2-6-12(10)16-9-11-5-3-7-13(17)14(11)18/h1-7,16-18H,9H2 |
| InChIKey | URTGHAOIWOPKFI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|