C16H14N2O2 — CID 43583479
2-(2,3-dihydro-1,4-benzodioxin-5-ylmethylamino)benzonitrile (PubChem CID 43583479) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-5-ylmethylamino)benzonitrile.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 43583479 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-5-ylmethylamino)benzonitrile |
| SMILES | N#Cc1ccccc1NCc1cccc2c1OCCO2 |
| InChI | InChI=1S/C16H14N2O2/c17-10-12-4-1-2-6-14(12)18-11-13-5-3-7-15-16(13)20-9-8-19-15/h1-7,18H,8-9,11H2 |
| InChIKey | DBHFCPOWAZVMEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |