C15H14ClNO2 — CID 43583497
2-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)aniline (PubChem CID 43583497) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)aniline.
| Compound Name | 2-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 43583497 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)aniline |
| SMILES | Clc1ccccc1NCc1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H14ClNO2/c16-12-5-1-2-6-13(12)17-10-11-4-3-7-14-15(11)19-9-8-18-14/h1-7,17H,8-10H2 |
| InChIKey | SHGIBISJRVJZKL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |