C15H13ClINO2 — CID 107631640
4-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-iodoaniline (PubChem CID 107631640) has the molecular formula C15H13ClINO2 and a molecular weight of 401.63 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-iodoaniline.
| Compound Name | 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-iodoaniline |
|---|---|
| PubChem CID | 107631640 |
| Molecular Formula | C15H13ClINO2 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-iodoaniline |
| SMILES | Clc1ccc(NCc2cccc3c2OCCO3)c(I)c1 |
| InChI | InChI=1S/C15H13ClINO2/c16-11-4-5-13(12(17)8-11)18-9-10-2-1-3-14-15(10)20-7-6-19-14/h1-5,8,18H,6-7,9H2 |
| InChIKey | INGFWTPSTHPPOH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|