C15H11BrN2O2 — CID 82708415
2-(1,3-benzodioxol-4-ylmethylamino)-5-bromobenzonitrile (PubChem CID 82708415) has the molecular formula C15H11BrN2O2 and a molecular weight of 331.17 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-4-ylmethylamino)-5-bromobenzonitrile.
| Compound Name | 2-(1,3-benzodioxol-4-ylmethylamino)-5-bromobenzonitrile |
|---|---|
| PubChem CID | 82708415 |
| Molecular Formula | C15H11BrN2O2 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-(1,3-benzodioxol-4-ylmethylamino)-5-bromobenzonitrile |
| SMILES | N#Cc1cc(Br)ccc1NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C15H11BrN2O2/c16-12-4-5-13(11(6-12)7-17)18-8-10-2-1-3-14-15(10)20-9-19-14/h1-6,18H,8-9H2 |
| InChIKey | CDWSSGMBUQIABB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |