C14H11BrFNO2 — CID 43583401
N-(1,3-benzodioxol-4-ylmethyl)-4-bromo-2-fluoroaniline (PubChem CID 43583401) has the molecular formula C14H11BrFNO2 and a molecular weight of 324.15 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-4-bromo-2-fluoroaniline.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-4-bromo-2-fluoroaniline |
|---|---|
| PubChem CID | 43583401 |
| Molecular Formula | C14H11BrFNO2 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-4-bromo-2-fluoroaniline |
| SMILES | Fc1cc(Br)ccc1NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C14H11BrFNO2/c15-10-4-5-12(11(16)6-10)17-7-9-2-1-3-13-14(9)19-8-18-13/h1-6,17H,7-8H2 |
| InChIKey | SOJCNIKXNIFFDN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |