C14H10Br2FNO2 — CID 43555204
5-bromo-N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoroaniline (PubChem CID 43555204) has the molecular formula C14H10Br2FNO2 and a molecular weight of 403.05 g/mol. Its IUPAC name is 5-bromo-N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoroaniline.
| Compound Name | 5-bromo-N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 43555204 |
| Molecular Formula | C14H10Br2FNO2 |
| Molecular Weight | 403.05 g/mol |
| Exact Mass | 400.91 |
| IUPAC Name | 5-bromo-N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoroaniline |
| SMILES | Fc1ccc(Br)cc1NCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H10Br2FNO2/c15-9-1-2-11(17)12(5-9)18-6-8-3-10(16)14-13(4-8)19-7-20-14/h1-5,18H,6-7H2 |
| InChIKey | ZIYNHMFDJGBAQD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.05 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |