C16H16BrNO3 — CID 106953819
4-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]-2,5-dimethylphenol (PubChem CID 106953819) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 4-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]-2,5-dimethylphenol.
| Compound Name | 4-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953819 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 4-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]-2,5-dimethylphenol |
| SMILES | Cc1cc(NCc2cc(Br)c3c(c2)OCO3)c(C)cc1O |
| InChI | InChI=1S/C16H16BrNO3/c1-9-4-14(19)10(2)3-13(9)18-7-11-5-12(17)16-15(6-11)20-8-21-16/h3-6,18-19H,7-8H2,1-2H3 |
| InChIKey | CVQLXIAODQCIHJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|