C9H9BrO2 — CID 130065754
4-bromo-6-ethyl-1,3-benzodioxole (PubChem CID 130065754) has the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. Its IUPAC name is 4-bromo-6-ethyl-1,3-benzodioxole.
| Compound Name | 4-bromo-6-ethyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 130065754 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 4-bromo-6-ethyl-1,3-benzodioxole |
| SMILES | CCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C9H9BrO2/c1-2-6-3-7(10)9-8(4-6)11-5-12-9/h3-4H,2,5H2,1H3 |
| InChIKey | IEEOGUXOWGODJN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |