C8H8BrNO4S — CID 165443563
(7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide (PubChem CID 165443563) has the molecular formula C8H8BrNO4S and a molecular weight of 294.13 g/mol. Its IUPAC name is (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide.
| Compound Name | (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 165443563 |
| Molecular Formula | C8H8BrNO4S |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C8H8BrNO4S/c9-6-1-5(3-15(10,11)12)2-7-8(6)14-4-13-7/h1-2H,3-4H2,(H2,10,11,12) |
| InChIKey | MQJDUGZKSDJWAJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |