About (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide
(7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide (PubChem CID 165443563) has the molecular formula C8H8BrNO4S
and a molecular weight of 294.13 g/mol. Its IUPAC name is (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide.
Molecular Properties
| Compound Name | (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide |
| PubChem CID | 165443563 |
| Molecular Formula | C8H8BrNO4S |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C8H8BrNO4S/c9-6-1-5(3-15(10,11)12)2-7-8(6)14-4-13-7/h1-2H,3-4H2,(H2,10,11,12) |
| InChIKey | MQJDUGZKSDJWAJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide?
The IUPAC name of (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide (CID 165443563) is (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide.
What is the SMILES notation for (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide?
The canonical SMILES for (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide is NS(=O)(=O)Cc1cc(Br)c2c(c1)OCO2.
What is the InChIKey of (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide?
The InChIKey is MQJDUGZKSDJWAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO4S/c9-6-1-5(3-15(10,11)12)2-7-8(6)14-4-13-7/h1-2H,3-4H2,(H2,10,11,12).
What are the key properties of (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide?
(7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide has a molecular weight of 294.13 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-1,3-benzodioxol-5-yl)methanesulfonamide is sourced from PubChem (CID 165443563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).