C10H14N2O4S — CID 83272130
6-[(dimethylamino)methyl]-1,3-benzodioxole-4-sulfonamide (PubChem CID 83272130) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 6-[(dimethylamino)methyl]-1,3-benzodioxole-4-sulfonamide.
| Compound Name | 6-[(dimethylamino)methyl]-1,3-benzodioxole-4-sulfonamide |
|---|---|
| PubChem CID | 83272130 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 6-[(dimethylamino)methyl]-1,3-benzodioxole-4-sulfonamide |
| SMILES | CN(C)Cc1cc2c(c(S(N)(=O)=O)c1)OCO2 |
| InChI | InChI=1S/C10H14N2O4S/c1-12(2)5-7-3-8-10(16-6-15-8)9(4-7)17(11,13)14/h3-4H,5-6H2,1-2H3,(H2,11,13,14) |
| InChIKey | SCNDVZQIHCHNBY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |